C33H37NO4 — CID 75288046
2-(4,8-dimethylnona-3,7-dienyl)-3,5-dihydroxy-2-methyl-8-naphthalen-1-yl-4,9-dihydro-3H-pyrano[2,3-e]isoindol-7-one (PubChem CID 75288046) has the molecular formula C33H37NO4 and a molecular weight of 511.66 g/mol. Its IUPAC name is 2-(4,8-dimethylnona-3,7-dienyl)-3,5-dihydroxy-2-methyl-8-naphthalen-1-yl-4,9-dihydro-3H-pyrano[2,3-e]isoindol-7-one.
| Compound Name | 2-(4,8-dimethylnona-3,7-dienyl)-3,5-dihydroxy-2-methyl-8-naphthalen-1-yl-4,9-dihydro-3H-pyrano[2,3-e]isoindol-7-one |
|---|---|
| PubChem CID | 75288046 |
| Molecular Formula | C33H37NO4 |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.27 |
| IUPAC Name | 2-(4,8-dimethylnona-3,7-dienyl)-3,5-dihydroxy-2-methyl-8-naphthalen-1-yl-4,9-dihydro-3H-pyrano[2,3-e]isoindol-7-one |
| SMILES | CC(C)=CCCC(C)=CCCC1(C)Oc2c(c(O)cc3c2CN(c2cccc4ccccc24)C3=O)CC1O |
| InChI | InChI=1S/C33H37NO4/c1-21(2)10-7-11-22(3)12-9-17-33(4)30(36)19-26-29(35)18-25-27(31(26)38-33)20-34(32(25)37)28-16-8-14-23-13-5-6-15-24(23)28/h5-6,8,10,12-16,18,30,35-36H,7,9,11,17,19-20H2,1-4H3 |
| InChIKey | CDMNNDQYIKWTKR-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|