C34H41N3O5 — CID 75288048
2-(4,8-dimethylnona-3,7-dienyl)-8-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3,5-dihydroxy-2-methyl-4,9-dihydro-3H-pyrano[2,3-e]isoindol-7-one (PubChem CID 75288048) has the molecular formula C34H41N3O5 and a molecular weight of 571.72 g/mol. Its IUPAC name is 2-(4,8-dimethylnona-3,7-dienyl)-8-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3,5-dihydroxy-2-methyl-4,9-dihydro-3H-pyrano[2,3-e]isoindol-7-one.
| Compound Name | 2-(4,8-dimethylnona-3,7-dienyl)-8-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3,5-dihydroxy-2-methyl-4,9-dihydro-3H-pyrano[2,3-e]isoindol-7-one |
|---|---|
| PubChem CID | 75288048 |
| Molecular Formula | C34H41N3O5 |
| Molecular Weight | 571.72 g/mol |
| Exact Mass | 571.30 |
| IUPAC Name | 2-(4,8-dimethylnona-3,7-dienyl)-8-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3,5-dihydroxy-2-methyl-4,9-dihydro-3H-pyrano[2,3-e]isoindol-7-one |
| SMILES | CC(C)=CCCC(C)=CCCC1(C)Oc2c(c(O)cc3c2CN(c2c(C)n(C)n(-c4ccccc4)c2=O)C3=O)CC1O |
| InChI | InChI=1S/C34H41N3O5/c1-21(2)12-10-13-22(3)14-11-17-34(5)29(39)19-26-28(38)18-25-27(31(26)42-34)20-36(32(25)40)30-23(4)35(6)37(33(30)41)24-15-8-7-9-16-24/h7-9,12,14-16,18,29,38-39H,10-11,13,17,19-20H2,1-6H3 |
| InChIKey | FMCIMICGCZJEKX-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 96.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.72 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|