C28H39NO6S — CID 139583556
(2S)-2-[(2S,3S)-2-(4,8-dimethylnona-3,7-dienyl)-3,5-dihydroxy-2-methyl-7-oxo-4,9-dihydro-3H-pyrano[2,3-e]isoindol-8-yl]-4-methylsulfanylbutanoic acid (PubChem CID 139583556) has the molecular formula C28H39NO6S and a molecular weight of 517.69 g/mol. Its IUPAC name is (2S)-2-[(2S,3S)-2-(4,8-dimethylnona-3,7-dienyl)-3,5-dihydroxy-2-methyl-7-oxo-4,9-dihydro-3H-pyrano[2,3-e]isoindol-8-yl]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[(2S,3S)-2-(4,8-dimethylnona-3,7-dienyl)-3,5-dihydroxy-2-methyl-7-oxo-4,9-dihydro-3H-pyrano[2,3-e]isoindol-8-yl]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 139583556 |
| Molecular Formula | C28H39NO6S |
| Molecular Weight | 517.69 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | (2S)-2-[(2S,3S)-2-(4,8-dimethylnona-3,7-dienyl)-3,5-dihydroxy-2-methyl-7-oxo-4,9-dihydro-3H-pyrano[2,3-e]isoindol-8-yl]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(C(=O)O)N1Cc2c(cc(O)c3c2O[C@@](C)(CCC=C(C)CCC=C(C)C)[C@@H](O)C3)C1=O |
| InChI | InChI=1S/C28H39NO6S/c1-17(2)8-6-9-18(3)10-7-12-28(4)24(31)15-20-23(30)14-19-21(25(20)35-28)16-29(26(19)32)22(27(33)34)11-13-36-5/h8,10,14,22,24,30-31H,6-7,9,11-13,15-16H2,1-5H3,(H,33,34)/t22?,24-,28-/m0/s1 |
| InChIKey | VADZLXWDWZCYAJ-WUGUIHSVSA-N |
| XLogP | 5.08 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.69 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|