C17H26O4 — CID 71484525
(4S,5R,6S,7aR)-6-hydroxy-4-(methoxymethoxymethyl)-4,5-dimethyl-7a-prop-2-enyl-1,5,6,7-tetrahydroinden-2-one (PubChem CID 71484525) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is (4S,5R,6S,7aR)-6-hydroxy-4-(methoxymethoxymethyl)-4,5-dimethyl-7a-prop-2-enyl-1,5,6,7-tetrahydroinden-2-one.
| Compound Name | (4S,5R,6S,7aR)-6-hydroxy-4-(methoxymethoxymethyl)-4,5-dimethyl-7a-prop-2-enyl-1,5,6,7-tetrahydroinden-2-one |
|---|---|
| PubChem CID | 71484525 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | (4S,5R,6S,7aR)-6-hydroxy-4-(methoxymethoxymethyl)-4,5-dimethyl-7a-prop-2-enyl-1,5,6,7-tetrahydroinden-2-one |
| SMILES | C=CC[C@@]12CC(=O)C=C1[C@@](C)(COCOC)[C@@H](C)[C@@H](O)C2 |
| InChI | InChI=1S/C17H26O4/c1-5-6-17-8-13(18)7-15(17)16(3,10-21-11-20-4)12(2)14(19)9-17/h5,7,12,14,19H,1,6,8-11H2,2-4H3/t12-,14-,16-,17-/m0/s1 |
| InChIKey | KHBMTKWTEBNMOA-CSFVBSKPSA-N |
| XLogP | 2.48 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|