C18H26O4 — CID 71484521
(1S,4S,5S,7aS)-7a-[(E)-2-methoxyethenyl]-4-(methoxymethoxymethyl)-1,4,5-trimethyl-1,5-dihydroinden-2-one (PubChem CID 71484521) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is (1S,4S,5S,7aS)-7a-[(E)-2-methoxyethenyl]-4-(methoxymethoxymethyl)-1,4,5-trimethyl-1,5-dihydroinden-2-one.
| Compound Name | (1S,4S,5S,7aS)-7a-[(E)-2-methoxyethenyl]-4-(methoxymethoxymethyl)-1,4,5-trimethyl-1,5-dihydroinden-2-one |
|---|---|
| PubChem CID | 71484521 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | (1S,4S,5S,7aS)-7a-[(E)-2-methoxyethenyl]-4-(methoxymethoxymethyl)-1,4,5-trimethyl-1,5-dihydroinden-2-one |
| SMILES | CO/C=C/[C@]12C=C[C@H](C)[C@](C)(COCOC)C1=CC(=O)[C@H]2C |
| InChI | InChI=1S/C18H26O4/c1-13-6-7-18(8-9-20-4)14(2)15(19)10-16(18)17(13,3)11-22-12-21-5/h6-10,13-14H,11-12H2,1-5H3/b9-8+/t13-,14+,17-,18-/m0/s1 |
| InChIKey | XHKWENCZUUDDPV-KCNRQWPMSA-N |
| XLogP | 3.11 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|