C14H24O6 — CID 71484393
(4R,5R,6R)-4-hydroxy-2,6-bis(methoxymethoxymethyl)-5,6-dimethylcyclohex-2-en-1-one (PubChem CID 71484393) has the molecular formula C14H24O6 and a molecular weight of 288.34 g/mol. Its IUPAC name is (4R,5R,6R)-4-hydroxy-2,6-bis(methoxymethoxymethyl)-5,6-dimethylcyclohex-2-en-1-one.
| Compound Name | (4R,5R,6R)-4-hydroxy-2,6-bis(methoxymethoxymethyl)-5,6-dimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 71484393 |
| Molecular Formula | C14H24O6 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | (4R,5R,6R)-4-hydroxy-2,6-bis(methoxymethoxymethyl)-5,6-dimethylcyclohex-2-en-1-one |
| SMILES | COCOCC1=C[C@@H](O)[C@H](C)[C@](C)(COCOC)C1=O |
| InChI | InChI=1S/C14H24O6/c1-10-12(15)5-11(6-19-8-17-3)13(16)14(10,2)7-20-9-18-4/h5,10,12,15H,6-9H2,1-4H3/t10-,12+,14-/m0/s1 |
| InChIKey | WYNZIIIJQTUFEJ-SUHUHFCYSA-N |
| XLogP | 0.74 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|