C22H40O5Si — CID 101441308
2-[(1R,3R,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxymethyl)-3,4-dimethyl-2-oxo-1-prop-2-enylcyclohexyl]acetaldehyde (PubChem CID 101441308) has the molecular formula C22H40O5Si and a molecular weight of 412.64 g/mol. Its IUPAC name is 2-[(1R,3R,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxymethyl)-3,4-dimethyl-2-oxo-1-prop-2-enylcyclohexyl]acetaldehyde.
| Compound Name | 2-[(1R,3R,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxymethyl)-3,4-dimethyl-2-oxo-1-prop-2-enylcyclohexyl]acetaldehyde |
|---|---|
| PubChem CID | 101441308 |
| Molecular Formula | C22H40O5Si |
| Molecular Weight | 412.64 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 2-[(1R,3R,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxymethyl)-3,4-dimethyl-2-oxo-1-prop-2-enylcyclohexyl]acetaldehyde |
| SMILES | C=CC[C@]1(CC=O)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@](C)(COCOC)C1=O |
| InChI | InChI=1S/C22H40O5Si/c1-10-11-22(12-13-23)14-18(27-28(8,9)20(3,4)5)17(2)21(6,19(22)24)15-26-16-25-7/h10,13,17-18H,1,11-12,14-16H2,2-9H3/t17-,18+,21-,22-/m0/s1 |
| InChIKey | MUFXUDRVILBFND-UDKICSLYSA-N |
| XLogP | 4.76 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.64 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|