C22H35NO2Si — CID 142700779
(3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1-[(1R)-1-phenylethyl]-3-prop-2-enylpyrrolidin-2-one (PubChem CID 142700779) has the molecular formula C22H35NO2Si and a molecular weight of 373.61 g/mol. Its IUPAC name is (3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1-[(1R)-1-phenylethyl]-3-prop-2-enylpyrrolidin-2-one.
| Compound Name | (3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1-[(1R)-1-phenylethyl]-3-prop-2-enylpyrrolidin-2-one |
|---|---|
| PubChem CID | 142700779 |
| Molecular Formula | C22H35NO2Si |
| Molecular Weight | 373.61 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | (3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1-[(1R)-1-phenylethyl]-3-prop-2-enylpyrrolidin-2-one |
| SMILES | C=CC[C@]1(C)C(=O)N([C@H](C)c2ccccc2)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H35NO2Si/c1-9-15-22(6)19(25-26(7,8)21(3,4)5)16-23(20(22)24)17(2)18-13-11-10-12-14-18/h9-14,17,19H,1,15-16H2,2-8H3/t17-,19-,22+/m1/s1 |
| InChIKey | GYYCPQUCDCVJMF-JUXOCIIHSA-N |
| XLogP | 5.56 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.61 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|