C15H28O3Si — CID 56946000
(1S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-1,3,3-trimethyl-7-oxabicyclo[4.1.0]heptan-2-one (PubChem CID 56946000) has the molecular formula C15H28O3Si and a molecular weight of 284.47 g/mol. Its IUPAC name is (1S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-1,3,3-trimethyl-7-oxabicyclo[4.1.0]heptan-2-one.
| Compound Name | (1S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-1,3,3-trimethyl-7-oxabicyclo[4.1.0]heptan-2-one |
|---|---|
| PubChem CID | 56946000 |
| Molecular Formula | C15H28O3Si |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | (1S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-1,3,3-trimethyl-7-oxabicyclo[4.1.0]heptan-2-one |
| SMILES | CC1(C)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[C@]2(C)C1=O |
| InChI | InChI=1S/C15H28O3Si/c1-13(2,3)19(7,8)18-10-9-14(4,5)12(16)15(6)11(10)17-15/h10-11H,9H2,1-8H3/t10-,11+,15+/m1/s1 |
| InChIKey | ZVFXYNDPZPXSHB-ZETOZRRWSA-N |
| XLogP | 3.53 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|