C16H28O3Si — CID 101189658
tert-butyl-[[(4R)-6,8-dimethyl-9-methylidene-2,7-dioxatricyclo[4.2.1.03,8]nonan-4-yl]oxy]-dimethylsilane (PubChem CID 101189658) has the molecular formula C16H28O3Si and a molecular weight of 296.48 g/mol. Its IUPAC name is tert-butyl-[[(4R)-6,8-dimethyl-9-methylidene-2,7-dioxatricyclo[4.2.1.03,8]nonan-4-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(4R)-6,8-dimethyl-9-methylidene-2,7-dioxatricyclo[4.2.1.03,8]nonan-4-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 101189658 |
| Molecular Formula | C16H28O3Si |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | tert-butyl-[[(4R)-6,8-dimethyl-9-methylidene-2,7-dioxatricyclo[4.2.1.03,8]nonan-4-yl]oxy]-dimethylsilane |
| SMILES | C=C1C2OC3[C@H](O[Si](C)(C)C(C)(C)C)CC1(C)OC23C |
| InChI | InChI=1S/C16H28O3Si/c1-10-12-16(6)13(17-12)11(9-15(10,5)19-16)18-20(7,8)14(2,3)4/h11-13H,1,9H2,2-8H3/t11-,12?,13?,15?,16?/m1/s1 |
| InChIKey | XOMMHMJPQQVROF-ZEGQCKKHSA-N |
| XLogP | 3.65 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|