C25H44O4Si — CID 99959947
(1R,3R,4S,8S,9R,12R,17R)-17-[tert-butyl(dimethyl)silyl]oxy-3,6,6-trimethyl-10-methylidene-5,7-dioxatetracyclo[10.4.1.01,8.04,8]heptadecan-9-ol (PubChem CID 99959947) has the molecular formula C25H44O4Si and a molecular weight of 436.71 g/mol. Its IUPAC name is (1R,3R,4S,8S,9R,12R,17R)-17-[tert-butyl(dimethyl)silyl]oxy-3,6,6-trimethyl-10-methylidene-5,7-dioxatetracyclo[10.4.1.01,8.04,8]heptadecan-9-ol.
| Compound Name | (1R,3R,4S,8S,9R,12R,17R)-17-[tert-butyl(dimethyl)silyl]oxy-3,6,6-trimethyl-10-methylidene-5,7-dioxatetracyclo[10.4.1.01,8.04,8]heptadecan-9-ol |
|---|---|
| PubChem CID | 99959947 |
| Molecular Formula | C25H44O4Si |
| Molecular Weight | 436.71 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | (1R,3R,4S,8S,9R,12R,17R)-17-[tert-butyl(dimethyl)silyl]oxy-3,6,6-trimethyl-10-methylidene-5,7-dioxatetracyclo[10.4.1.01,8.04,8]heptadecan-9-ol |
| SMILES | C=C1C[C@H]2CCCC[C@@]3(C[C@@H](C)[C@@H]4OC(C)(C)O[C@@]43[C@@H]1O)[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H44O4Si/c1-16-14-18-12-10-11-13-24(21(18)28-30(8,9)22(3,4)5)15-17(2)20-25(24,19(16)26)29-23(6,7)27-20/h17-21,26H,1,10-15H2,2-9H3/t17-,18-,19-,20+,21-,24-,25+/m1/s1 |
| InChIKey | MNYIPKPYTRTOGC-CZIXYAIYSA-N |
| XLogP | 5.80 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.71 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|