C20H41BrO2Si2 — CID 11305476
[(2S,3R,5R)-3-bromo-2-[tert-butyl(dimethyl)silyl]oxy-5-cyclohexyloxolan-3-yl]methyl-trimethylsilane (PubChem CID 11305476) has the molecular formula C20H41BrO2Si2 and a molecular weight of 449.62 g/mol. Its IUPAC name is [(2S,3R,5R)-3-bromo-2-[tert-butyl(dimethyl)silyl]oxy-5-cyclohexyloxolan-3-yl]methyl-trimethylsilane.
| Compound Name | [(2S,3R,5R)-3-bromo-2-[tert-butyl(dimethyl)silyl]oxy-5-cyclohexyloxolan-3-yl]methyl-trimethylsilane |
|---|---|
| PubChem CID | 11305476 |
| Molecular Formula | C20H41BrO2Si2 |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | [(2S,3R,5R)-3-bromo-2-[tert-butyl(dimethyl)silyl]oxy-5-cyclohexyloxolan-3-yl]methyl-trimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1O[C@@H](C2CCCCC2)C[C@]1(Br)C[Si](C)(C)C |
| InChI | InChI=1S/C20H41BrO2Si2/c1-19(2,3)25(7,8)23-18-20(21,15-24(4,5)6)14-17(22-18)16-12-10-9-11-13-16/h16-18H,9-15H2,1-8H3/t17-,18+,20+/m1/s1 |
| InChIKey | GHRJCKXIOSQJKR-HBFSDRIKSA-N |
| XLogP | 7.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|