C23H47BrO2Si2 — CID 12964921
[(2S,3R,5S)-3-bromo-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-non-3-enyl]oxolan-3-yl]methyl-trimethylsilane (PubChem CID 12964921) has the molecular formula C23H47BrO2Si2 and a molecular weight of 491.70 g/mol. Its IUPAC name is [(2S,3R,5S)-3-bromo-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-non-3-enyl]oxolan-3-yl]methyl-trimethylsilane.
| Compound Name | [(2S,3R,5S)-3-bromo-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-non-3-enyl]oxolan-3-yl]methyl-trimethylsilane |
|---|---|
| PubChem CID | 12964921 |
| Molecular Formula | C23H47BrO2Si2 |
| Molecular Weight | 491.70 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | [(2S,3R,5S)-3-bromo-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-non-3-enyl]oxolan-3-yl]methyl-trimethylsilane |
| SMILES | CCCCC/C=C/CC[C@H]1C[C@](Br)(C[Si](C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C23H47BrO2Si2/c1-10-11-12-13-14-15-16-17-20-18-23(24,19-27(5,6)7)21(25-20)26-28(8,9)22(2,3)4/h14-15,20-21H,10-13,16-19H2,1-9H3/b15-14+/t20-,21-,23-/m0/s1 |
| InChIKey | KRJSMOKAMWVADY-KBCVUAANSA-N |
| XLogP | 8.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.70 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|