C32H58O5Si — CID 11497661
(3S,4aR,7S,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-8a-[(Z)-heptadec-10-enyl]-3-methyl-4a,5,7,8-tetrahydrobenzo[b][1,4]dioxine-2,6-dione (PubChem CID 11497661) has the molecular formula C32H58O5Si and a molecular weight of 550.90 g/mol. Its IUPAC name is (3S,4aR,7S,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-8a-[(Z)-heptadec-10-enyl]-3-methyl-4a,5,7,8-tetrahydrobenzo[b][1,4]dioxine-2,6-dione.
| Compound Name | (3S,4aR,7S,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-8a-[(Z)-heptadec-10-enyl]-3-methyl-4a,5,7,8-tetrahydrobenzo[b][1,4]dioxine-2,6-dione |
|---|---|
| PubChem CID | 11497661 |
| Molecular Formula | C32H58O5Si |
| Molecular Weight | 550.90 g/mol |
| Exact Mass | 550.41 |
| IUPAC Name | (3S,4aR,7S,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-8a-[(Z)-heptadec-10-enyl]-3-methyl-4a,5,7,8-tetrahydrobenzo[b][1,4]dioxine-2,6-dione |
| SMILES | CCCCCC/C=C\CCCCCCCCC[C@@]12C[C@H](O[Si](C)(C)C(C)(C)C)C(=O)C[C@H]1O[C@@H](C)C(=O)O2 |
| InChI | InChI=1S/C32H58O5Si/c1-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-32-25-28(37-38(6,7)31(3,4)5)27(33)24-29(32)35-26(2)30(34)36-32/h13-14,26,28-29H,8-12,15-25H2,1-7H3/b14-13-/t26-,28-,29+,32+/m0/s1 |
| InChIKey | DXMKDZGGSHUVRB-PXIOQAHPSA-N |
| XLogP | 8.85 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.90 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|