C28H46O3Si — CID 10551865
(3S,4aR,8S,9aR,9bR)-8-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-[(E)-non-1-enyl]-4a,7,8,9,9a,9b-hexahydro-3H-cyclopenta[f]chromen-5-one (PubChem CID 10551865) has the molecular formula C28H46O3Si and a molecular weight of 458.76 g/mol. Its IUPAC name is (3S,4aR,8S,9aR,9bR)-8-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-[(E)-non-1-enyl]-4a,7,8,9,9a,9b-hexahydro-3H-cyclopenta[f]chromen-5-one.
| Compound Name | (3S,4aR,8S,9aR,9bR)-8-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-[(E)-non-1-enyl]-4a,7,8,9,9a,9b-hexahydro-3H-cyclopenta[f]chromen-5-one |
|---|---|
| PubChem CID | 10551865 |
| Molecular Formula | C28H46O3Si |
| Molecular Weight | 458.76 g/mol |
| Exact Mass | 458.32 |
| IUPAC Name | (3S,4aR,8S,9aR,9bR)-8-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-[(E)-non-1-enyl]-4a,7,8,9,9a,9b-hexahydro-3H-cyclopenta[f]chromen-5-one |
| SMILES | CCCCCCC/C=C/[C@@H]1O[C@H]2C(=O)C=C3C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]3[C@H]2C=C1C |
| InChI | InChI=1S/C28H46O3Si/c1-8-9-10-11-12-13-14-15-26-20(2)16-24-23-19-22(31-32(6,7)28(3,4)5)17-21(23)18-25(29)27(24)30-26/h14-16,18,22-24,26-27H,8-13,17,19H2,1-7H3/b15-14+/t22-,23+,24-,26+,27-/m1/s1 |
| InChIKey | MEGZWIZPMNOFQM-ANTJXHSSSA-N |
| XLogP | 7.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.76 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|