C23H34O5 — CID 10834264
(1R,3R,5S,6R,9R,11S,15R)-3,15-dihydroxy-8-methyl-9-[(E)-non-1-enyl]-10,13-dioxatetracyclo[9.2.2.01,5.06,11]pentadec-7-en-12-one (PubChem CID 10834264) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is (1R,3R,5S,6R,9R,11S,15R)-3,15-dihydroxy-8-methyl-9-[(E)-non-1-enyl]-10,13-dioxatetracyclo[9.2.2.01,5.06,11]pentadec-7-en-12-one.
| Compound Name | (1R,3R,5S,6R,9R,11S,15R)-3,15-dihydroxy-8-methyl-9-[(E)-non-1-enyl]-10,13-dioxatetracyclo[9.2.2.01,5.06,11]pentadec-7-en-12-one |
|---|---|
| PubChem CID | 10834264 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | (1R,3R,5S,6R,9R,11S,15R)-3,15-dihydroxy-8-methyl-9-[(E)-non-1-enyl]-10,13-dioxatetracyclo[9.2.2.01,5.06,11]pentadec-7-en-12-one |
| SMILES | CCCCCCC/C=C/[C@H]1O[C@@]23C(=O)O[C@]4(C[C@H](O)C[C@H]4[C@H]2C=C1C)C[C@H]3O |
| InChI | InChI=1S/C23H34O5/c1-3-4-5-6-7-8-9-10-19-15(2)11-18-17-12-16(24)13-22(17)14-20(25)23(18,27-19)21(26)28-22/h9-11,16-20,24-25H,3-8,12-14H2,1-2H3/b10-9+/t16-,17+,18-,19-,20-,22-,23+/m1/s1 |
| InChIKey | WLNUWQMGOYCODU-GFFGDELSSA-N |
| XLogP | 3.43 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|