C16H28O2 — CID 67805506
[(3R,6S)-3-methyl-6-[(E)-non-1-enyl]-3,6-dihydro-2H-pyran-5-yl]methanol (PubChem CID 67805506) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is [(3R,6S)-3-methyl-6-[(E)-non-1-enyl]-3,6-dihydro-2H-pyran-5-yl]methanol.
| Compound Name | [(3R,6S)-3-methyl-6-[(E)-non-1-enyl]-3,6-dihydro-2H-pyran-5-yl]methanol |
|---|---|
| PubChem CID | 67805506 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | [(3R,6S)-3-methyl-6-[(E)-non-1-enyl]-3,6-dihydro-2H-pyran-5-yl]methanol |
| SMILES | CCCCCCC/C=C/[C@@H]1OC[C@H](C)C=C1CO |
| InChI | InChI=1S/C16H28O2/c1-3-4-5-6-7-8-9-10-16-15(12-17)11-14(2)13-18-16/h9-11,14,16-17H,3-8,12-13H2,1-2H3/b10-9+/t14-,16+/m1/s1 |
| InChIKey | BKZCVZOJFQPLHZ-MVHLYKQMSA-N |
| XLogP | 3.86 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|