C18H28O4 — CID 146684226
(1aR,2R,3R,6R,6aS)-3-[(E)-dec-1-enyl]-1a,2,3,5,6,6a-hexahydrooxireno[2,3-f][2]benzofuran-2,6-diol (PubChem CID 146684226) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is (1aR,2R,3R,6R,6aS)-3-[(E)-dec-1-enyl]-1a,2,3,5,6,6a-hexahydrooxireno[2,3-f][2]benzofuran-2,6-diol.
| Compound Name | (1aR,2R,3R,6R,6aS)-3-[(E)-dec-1-enyl]-1a,2,3,5,6,6a-hexahydrooxireno[2,3-f][2]benzofuran-2,6-diol |
|---|---|
| PubChem CID | 146684226 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | (1aR,2R,3R,6R,6aS)-3-[(E)-dec-1-enyl]-1a,2,3,5,6,6a-hexahydrooxireno[2,3-f][2]benzofuran-2,6-diol |
| SMILES | CCCCCCCC/C=C/[C@H]1OCC2=C1[C@@H](O)[C@H]1O[C@H]1[C@@H]2O |
| InChI | InChI=1S/C18H28O4/c1-2-3-4-5-6-7-8-9-10-13-14-12(11-21-13)15(19)17-18(22-17)16(14)20/h9-10,13,15-20H,2-8,11H2,1H3/b10-9+/t13-,15-,16-,17+,18-/m1/s1 |
| InChIKey | YXMHQWJPKMZBCK-XHIWFTMBSA-N |
| XLogP | 2.49 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|