C21H34NO2+ — CID 101100878
4-[5-[(E)-dec-1-enyl]-1,3-dioxan-2-yl]-1-ethylpyridin-1-ium (PubChem CID 101100878) has the molecular formula C21H34NO2+ and a molecular weight of 332.51 g/mol. Its IUPAC name is 4-[5-[(E)-dec-1-enyl]-1,3-dioxan-2-yl]-1-ethylpyridin-1-ium.
| Compound Name | 4-[5-[(E)-dec-1-enyl]-1,3-dioxan-2-yl]-1-ethylpyridin-1-ium |
|---|---|
| PubChem CID | 101100878 |
| Molecular Formula | C21H34NO2+ |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.26 |
| IUPAC Name | 4-[5-[(E)-dec-1-enyl]-1,3-dioxan-2-yl]-1-ethylpyridin-1-ium |
| SMILES | CCCCCCCC/C=C/C1COC(c2cc[n+](CC)cc2)OC1 |
| InChI | InChI=1S/C21H34NO2/c1-3-5-6-7-8-9-10-11-12-19-17-23-21(24-18-19)20-13-15-22(4-2)16-14-20/h11-16,19,21H,3-10,17-18H2,1-2H3/q+1/b12-11+ |
| InChIKey | MSHWZOZFDNISSN-VAWYXSNFSA-N |
| XLogP | 4.96 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|