C21H36BrNOS — CID 139786316
4-(5-decyl-1,3-oxathian-2-yl)-1-ethylpyridin-1-ium bromide (PubChem CID 139786316) has the molecular formula C21H36BrNOS and a molecular weight of 430.50 g/mol. Its IUPAC name is 4-(5-decyl-1,3-oxathian-2-yl)-1-ethylpyridin-1-ium bromide.
| Compound Name | 4-(5-decyl-1,3-oxathian-2-yl)-1-ethylpyridin-1-ium bromide |
|---|---|
| PubChem CID | 139786316 |
| Molecular Formula | C21H36BrNOS |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 4-(5-decyl-1,3-oxathian-2-yl)-1-ethylpyridin-1-ium bromide |
| SMILES | CCCCCCCCCCC1COC(c2cc[n+](CC)cc2)SC1.[Br-] |
| InChI | InChI=1S/C21H36NOS.BrH/c1-3-5-6-7-8-9-10-11-12-19-17-23-21(24-18-19)20-13-15-22(4-2)16-14-20;/h13-16,19,21H,3-12,17-18H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | KHWNRCOUCQSRLH-UHFFFAOYSA-M |
| XLogP | 2.91 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|