C33H52N2O4+2 — CID 86294160
1-octyl-4-[3-(1-octylpyridin-1-ium-4-yl)-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]pyridin-1-ium (PubChem CID 86294160) has the molecular formula C33H52N2O4+2 and a molecular weight of 540.79 g/mol. Its IUPAC name is 1-octyl-4-[3-(1-octylpyridin-1-ium-4-yl)-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]pyridin-1-ium.
| Compound Name | 1-octyl-4-[3-(1-octylpyridin-1-ium-4-yl)-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]pyridin-1-ium |
|---|---|
| PubChem CID | 86294160 |
| Molecular Formula | C33H52N2O4+2 |
| Molecular Weight | 540.79 g/mol |
| Exact Mass | 540.39 |
| IUPAC Name | 1-octyl-4-[3-(1-octylpyridin-1-ium-4-yl)-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]pyridin-1-ium |
| SMILES | CCCCCCCC[n+]1ccc(C2OCC3(CO2)COC(c2cc[n+](CCCCCCCC)cc2)OC3)cc1 |
| InChI | InChI=1S/C33H52N2O4/c1-3-5-7-9-11-13-19-34-21-15-29(16-22-34)31-36-25-33(26-37-31)27-38-32(39-28-33)30-17-23-35(24-18-30)20-14-12-10-8-6-4-2/h15-18,21-24,31-32H,3-14,19-20,25-28H2,1-2H3/q+2 |
| InChIKey | NRRAYPUIOAVGDN-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 44.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.79 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|