C22H36ClNS2 — CID 139786318
4-(5-decyl-1,3-dithian-2-yl)-1-prop-2-enylpyridin-1-ium chloride (PubChem CID 139786318) has the molecular formula C22H36ClNS2 and a molecular weight of 414.12 g/mol. Its IUPAC name is 4-(5-decyl-1,3-dithian-2-yl)-1-prop-2-enylpyridin-1-ium chloride.
| Compound Name | 4-(5-decyl-1,3-dithian-2-yl)-1-prop-2-enylpyridin-1-ium chloride |
|---|---|
| PubChem CID | 139786318 |
| Molecular Formula | C22H36ClNS2 |
| Molecular Weight | 414.12 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 4-(5-decyl-1,3-dithian-2-yl)-1-prop-2-enylpyridin-1-ium chloride |
| SMILES | C=CC[n+]1ccc(C2SCC(CCCCCCCCCC)CS2)cc1.[Cl-] |
| InChI | InChI=1S/C22H36NS2.ClH/c1-3-5-6-7-8-9-10-11-12-20-18-24-22(25-19-20)21-13-16-23(15-4-2)17-14-21;/h4,13-14,16-17,20,22H,2-3,5-12,15,18-19H2,1H3;1H/q+1;/p-1 |
| InChIKey | SWJCAJZPILPDKM-UHFFFAOYSA-M |
| XLogP | 3.79 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.12 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|