C19H29N — CID 102028978
(2R,4S)-4-hexyl-2-phenyl-1-prop-2-enylpyrrolidine (PubChem CID 102028978) has the molecular formula C19H29N and a molecular weight of 271.45 g/mol. Its IUPAC name is (2R,4S)-4-hexyl-2-phenyl-1-prop-2-enylpyrrolidine.
| Compound Name | (2R,4S)-4-hexyl-2-phenyl-1-prop-2-enylpyrrolidine |
|---|---|
| PubChem CID | 102028978 |
| Molecular Formula | C19H29N |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | (2R,4S)-4-hexyl-2-phenyl-1-prop-2-enylpyrrolidine |
| SMILES | C=CCN1C[C@@H](CCCCCC)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C19H29N/c1-3-5-6-8-11-17-15-19(20(16-17)14-4-2)18-12-9-7-10-13-18/h4,7,9-10,12-13,17,19H,2-3,5-6,8,11,14-16H2,1H3/t17-,19+/m0/s1 |
| InChIKey | VLDHFBKMZRHIKI-PKOBYXMFSA-N |
| XLogP | 5.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|