C23H31NO — CID 11002237
(3S,5S)-5-octyl-2,3-diphenyl-1,2-oxazolidine (PubChem CID 11002237) has the molecular formula C23H31NO and a molecular weight of 337.51 g/mol. Its IUPAC name is (3S,5S)-5-octyl-2,3-diphenyl-1,2-oxazolidine.
| Compound Name | (3S,5S)-5-octyl-2,3-diphenyl-1,2-oxazolidine |
|---|---|
| PubChem CID | 11002237 |
| Molecular Formula | C23H31NO |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | (3S,5S)-5-octyl-2,3-diphenyl-1,2-oxazolidine |
| SMILES | CCCCCCCC[C@H]1C[C@@H](c2ccccc2)N(c2ccccc2)O1 |
| InChI | InChI=1S/C23H31NO/c1-2-3-4-5-6-13-18-22-19-23(20-14-9-7-10-15-20)24(25-22)21-16-11-8-12-17-21/h7-12,14-17,22-23H,2-6,13,18-19H2,1H3/t22-,23-/m0/s1 |
| InChIKey | JOLWWCYBRMREAY-GOTSBHOMSA-N |
| XLogP | 6.69 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|