C19H29O2 — CID 102011532
CID 102011532 (PubChem CID 102011532) has the molecular formula C19H29O2 and a molecular weight of 289.44 g/mol.
| Compound Name | CID 102011532 |
|---|---|
| PubChem CID | 102011532 |
| Molecular Formula | C19H29O2 |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | — |
| SMILES | [CH2][C@@H]1C[C@H](CCCCCCCC)O[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C19H29O2/c1-3-4-5-6-7-11-14-18-15-16(2)20-19(21-18)17-12-9-8-10-13-17/h8-10,12-13,16,18-19H,2-7,11,14-15H2,1H3/t16-,18+,19-/m1/s1 |
| InChIKey | RVJDGHWHCVYKQM-NZSAHSFTSA-N |
| XLogP | 5.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|