C33H46O5 — CID 56849902
(2S)-1-[(2S,4S,6S)-6-[[(2R,4R,6R)-6-heptyl-2-phenyl-1,3-dioxan-4-yl]methyl]-2-phenyl-1,3-dioxan-4-yl]pent-4-en-2-ol (PubChem CID 56849902) has the molecular formula C33H46O5 and a molecular weight of 522.73 g/mol. Its IUPAC name is (2S)-1-[(2S,4S,6S)-6-[[(2R,4R,6R)-6-heptyl-2-phenyl-1,3-dioxan-4-yl]methyl]-2-phenyl-1,3-dioxan-4-yl]pent-4-en-2-ol.
| Compound Name | (2S)-1-[(2S,4S,6S)-6-[[(2R,4R,6R)-6-heptyl-2-phenyl-1,3-dioxan-4-yl]methyl]-2-phenyl-1,3-dioxan-4-yl]pent-4-en-2-ol |
|---|---|
| PubChem CID | 56849902 |
| Molecular Formula | C33H46O5 |
| Molecular Weight | 522.73 g/mol |
| Exact Mass | 522.33 |
| IUPAC Name | (2S)-1-[(2S,4S,6S)-6-[[(2R,4R,6R)-6-heptyl-2-phenyl-1,3-dioxan-4-yl]methyl]-2-phenyl-1,3-dioxan-4-yl]pent-4-en-2-ol |
| SMILES | C=CC[C@H](O)C[C@H]1C[C@@H](C[C@H]2C[C@@H](CCCCCCC)O[C@@H](c3ccccc3)O2)O[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C33H46O5/c1-3-5-6-7-14-20-28-22-30(37-32(35-28)25-16-10-8-11-17-25)24-31-23-29(21-27(34)15-4-2)36-33(38-31)26-18-12-9-13-19-26/h4,8-13,16-19,27-34H,2-3,5-7,14-15,20-24H2,1H3/t27-,28+,29-,30+,31-,32+,33-/m0/s1 |
| InChIKey | ZOQPDAALPAKPBV-BIADQWRFSA-N |
| XLogP | 7.81 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.73 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|