C24H28O5 — CID 11749823
2-[(2S,4S,6S)-6-[[(2S,4S,6S)-6-methyl-2-phenyl-1,3-dioxan-4-yl]methyl]-2-phenyl-1,3-dioxan-4-yl]acetaldehyde (PubChem CID 11749823) has the molecular formula C24H28O5 and a molecular weight of 396.48 g/mol. Its IUPAC name is 2-[(2S,4S,6S)-6-[[(2S,4S,6S)-6-methyl-2-phenyl-1,3-dioxan-4-yl]methyl]-2-phenyl-1,3-dioxan-4-yl]acetaldehyde.
| Compound Name | 2-[(2S,4S,6S)-6-[[(2S,4S,6S)-6-methyl-2-phenyl-1,3-dioxan-4-yl]methyl]-2-phenyl-1,3-dioxan-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 11749823 |
| Molecular Formula | C24H28O5 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 2-[(2S,4S,6S)-6-[[(2S,4S,6S)-6-methyl-2-phenyl-1,3-dioxan-4-yl]methyl]-2-phenyl-1,3-dioxan-4-yl]acetaldehyde |
| SMILES | C[C@H]1C[C@@H](C[C@H]2C[C@@H](CC=O)O[C@@H](c3ccccc3)O2)O[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C24H28O5/c1-17-14-21(28-23(26-17)18-8-4-2-5-9-18)16-22-15-20(12-13-25)27-24(29-22)19-10-6-3-7-11-19/h2-11,13,17,20-24H,12,14-16H2,1H3/t17-,20+,21-,22+,23-,24+/m0/s1 |
| InChIKey | WCDWRCJDSZCTNN-PYTRAXROSA-N |
| XLogP | 4.73 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|