C17H28O3 — CID 91399868
butan-2-ol;4-ethyl-6-methyl-2-phenyl-1,3-dioxane (PubChem CID 91399868) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is butan-2-ol;4-ethyl-6-methyl-2-phenyl-1,3-dioxane.
| Compound Name | butan-2-ol;4-ethyl-6-methyl-2-phenyl-1,3-dioxane |
|---|---|
| PubChem CID | 91399868 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | butan-2-ol;4-ethyl-6-methyl-2-phenyl-1,3-dioxane |
| SMILES | CCC(C)O.CCC1CC(C)OC(c2ccccc2)O1 |
| InChI | InChI=1S/C13H18O2.C4H10O/c1-3-12-9-10(2)14-13(15-12)11-7-5-4-6-8-11;1-3-4(2)5/h4-8,10,12-13H,3,9H2,1-2H3;4-5H,3H2,1-2H3 |
| InChIKey | HYBYPFBQDMYUMW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |