C18H38O5 — CID 160815637
butan-2-ol;butan-2-yl acetate;4-ethyl-2,6-dimethyl-1,3-dioxane (PubChem CID 160815637) has the molecular formula C18H38O5 and a molecular weight of 334.50 g/mol. Its IUPAC name is butan-2-ol;butan-2-yl acetate;4-ethyl-2,6-dimethyl-1,3-dioxane.
| Compound Name | butan-2-ol;butan-2-yl acetate;4-ethyl-2,6-dimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 160815637 |
| Molecular Formula | C18H38O5 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.27 |
| IUPAC Name | butan-2-ol;butan-2-yl acetate;4-ethyl-2,6-dimethyl-1,3-dioxane |
| SMILES | CCC(C)O.CCC(C)OC(C)=O.CCC1CC(C)OC(C)O1 |
| InChI | InChI=1S/C8H16O2.C6H12O2.C4H10O/c1-4-8-5-6(2)9-7(3)10-8;1-4-5(2)8-6(3)7;1-3-4(2)5/h6-8H,4-5H2,1-3H3;5H,4H2,1-3H3;4-5H,3H2,1-2H3 |
| InChIKey | SEWCOWFREYSGTP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |