About [5-(6-ethyl-1,3-dioxan-4-yl)-4-hydroxypentan-2-yl] acetate
[5-(6-ethyl-1,3-dioxan-4-yl)-4-hydroxypentan-2-yl] acetate (PubChem CID 20683523) has the molecular formula C13H24O5
and a molecular weight of 260.33 g/mol. Its IUPAC name is [5-(6-ethyl-1,3-dioxan-4-yl)-4-hydroxypentan-2-yl] acetate.
Analyze [5-(6-ethyl-1,3-dioxan-4-yl)-4-hydroxypentan-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(6-ethyl-1,3-dioxan-4-yl)-4-hydroxypentan-2-yl] acetate?
The IUPAC name of [5-(6-ethyl-1,3-dioxan-4-yl)-4-hydroxypentan-2-yl] acetate (CID 20683523) is [5-(6-ethyl-1,3-dioxan-4-yl)-4-hydroxypentan-2-yl] acetate.
What is the SMILES notation for [5-(6-ethyl-1,3-dioxan-4-yl)-4-hydroxypentan-2-yl] acetate?
The canonical SMILES for [5-(6-ethyl-1,3-dioxan-4-yl)-4-hydroxypentan-2-yl] acetate is CCC1CC(CC(O)CC(C)OC(C)=O)OCO1.
What is the InChIKey of [5-(6-ethyl-1,3-dioxan-4-yl)-4-hydroxypentan-2-yl] acetate?
The InChIKey is DCFBAACWVVKPOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O5/c1-4-12-7-13(17-8-16-12)6-11(15)5-9(2)18-10(3)14/h9,11-13,15H,4-8H2,1-3H3.
What are the key properties of [5-(6-ethyl-1,3-dioxan-4-yl)-4-hydroxypentan-2-yl] acetate?
[5-(6-ethyl-1,3-dioxan-4-yl)-4-hydroxypentan-2-yl] acetate has a molecular weight of 260.33 g/mol, XLogP of 1.62, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(6-ethyl-1,3-dioxan-4-yl)-4-hydroxypentan-2-yl] acetate is sourced from PubChem (CID 20683523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).