C14H19FO2 — CID 59916910
4-ethyl-2-(3-fluoro-2-methylphenyl)-6-methyl-1,3-dioxane (PubChem CID 59916910) has the molecular formula C14H19FO2 and a molecular weight of 238.30 g/mol. Its IUPAC name is 4-ethyl-2-(3-fluoro-2-methylphenyl)-6-methyl-1,3-dioxane.
| Compound Name | 4-ethyl-2-(3-fluoro-2-methylphenyl)-6-methyl-1,3-dioxane |
|---|---|
| PubChem CID | 59916910 |
| Molecular Formula | C14H19FO2 |
| Molecular Weight | 238.30 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 4-ethyl-2-(3-fluoro-2-methylphenyl)-6-methyl-1,3-dioxane |
| SMILES | CCC1CC(C)OC(c2cccc(F)c2C)O1 |
| InChI | InChI=1S/C14H19FO2/c1-4-11-8-9(2)16-14(17-11)12-6-5-7-13(15)10(12)3/h5-7,9,11,14H,4,8H2,1-3H3 |
| InChIKey | JXZPNMTZCUSVBY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.30 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |