C26H36O4Si — CID 25111300
2-[(2S,4S,6S)-6-[2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]ethyl]-2-phenyl-1,3-dioxan-4-yl]acetaldehyde (PubChem CID 25111300) has the molecular formula C26H36O4Si and a molecular weight of 440.66 g/mol. Its IUPAC name is 2-[(2S,4S,6S)-6-[2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]ethyl]-2-phenyl-1,3-dioxan-4-yl]acetaldehyde.
| Compound Name | 2-[(2S,4S,6S)-6-[2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]ethyl]-2-phenyl-1,3-dioxan-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 25111300 |
| Molecular Formula | C26H36O4Si |
| Molecular Weight | 440.66 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 2-[(2S,4S,6S)-6-[2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]ethyl]-2-phenyl-1,3-dioxan-4-yl]acetaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(CC[C@H]2C[C@@H](CC=O)O[C@@H](c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C26H36O4Si/c1-26(2,3)31(4,5)30-22-14-11-20(12-15-22)13-16-23-19-24(17-18-27)29-25(28-23)21-9-7-6-8-10-21/h6-12,14-15,18,23-25H,13,16-17,19H2,1-5H3/t23-,24+,25-/m0/s1 |
| InChIKey | UYVLLTWTVCDPFC-GVAUOCQISA-N |
| XLogP | 6.47 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.66 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|