C24H31NO4 — CID 11211665
N-methoxy-N-methyl-2-[(2R,4R,6R)-2-phenyl-6-(4-phenylbutyl)-1,3-dioxan-4-yl]acetamide (PubChem CID 11211665) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is N-methoxy-N-methyl-2-[(2R,4R,6R)-2-phenyl-6-(4-phenylbutyl)-1,3-dioxan-4-yl]acetamide.
| Compound Name | N-methoxy-N-methyl-2-[(2R,4R,6R)-2-phenyl-6-(4-phenylbutyl)-1,3-dioxan-4-yl]acetamide |
|---|---|
| PubChem CID | 11211665 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | N-methoxy-N-methyl-2-[(2R,4R,6R)-2-phenyl-6-(4-phenylbutyl)-1,3-dioxan-4-yl]acetamide |
| SMILES | CON(C)C(=O)C[C@H]1C[C@@H](CCCCc2ccccc2)O[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C24H31NO4/c1-25(27-2)23(26)18-22-17-21(16-10-9-13-19-11-5-3-6-12-19)28-24(29-22)20-14-7-4-8-15-20/h3-8,11-12,14-15,21-22,24H,9-10,13,16-18H2,1-2H3/t21-,22-,24-/m1/s1 |
| InChIKey | NBIMHJAEQZWUBZ-CQOQZXRMSA-N |
| XLogP | 4.68 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|