C23H29N3O4S — CID 102169177
2-[[(2R,4R,6R)-6-hexyl-2-phenyl-1,3-dioxan-4-yl]methylsulfonyl]benzotriazole (PubChem CID 102169177) has the molecular formula C23H29N3O4S and a molecular weight of 443.57 g/mol. Its IUPAC name is 2-[[(2R,4R,6R)-6-hexyl-2-phenyl-1,3-dioxan-4-yl]methylsulfonyl]benzotriazole.
| Compound Name | 2-[[(2R,4R,6R)-6-hexyl-2-phenyl-1,3-dioxan-4-yl]methylsulfonyl]benzotriazole |
|---|---|
| PubChem CID | 102169177 |
| Molecular Formula | C23H29N3O4S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 2-[[(2R,4R,6R)-6-hexyl-2-phenyl-1,3-dioxan-4-yl]methylsulfonyl]benzotriazole |
| SMILES | CCCCCC[C@@H]1C[C@H](CS(=O)(=O)n2nc3ccccc3n2)O[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C23H29N3O4S/c1-2-3-4-8-13-19-16-20(30-23(29-19)18-11-6-5-7-12-18)17-31(27,28)26-24-21-14-9-10-15-22(21)25-26/h5-7,9-12,14-15,19-20,23H,2-4,8,13,16-17H2,1H3/t19-,20-,23-/m1/s1 |
| InChIKey | NJBIACUDVRMXEB-TXTKFYIRSA-N |
| XLogP | 4.45 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|