C17H15NO — CID 40522680
(3R,5S)-5-ethynyl-2,3-diphenyl-1,2-oxazolidine (PubChem CID 40522680) has the molecular formula C17H15NO and a molecular weight of 249.31 g/mol. Its IUPAC name is (3R,5S)-5-ethynyl-2,3-diphenyl-1,2-oxazolidine.
| Compound Name | (3R,5S)-5-ethynyl-2,3-diphenyl-1,2-oxazolidine |
|---|---|
| PubChem CID | 40522680 |
| Molecular Formula | C17H15NO |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | (3R,5S)-5-ethynyl-2,3-diphenyl-1,2-oxazolidine |
| SMILES | C#C[C@@H]1C[C@H](c2ccccc2)N(c2ccccc2)O1 |
| InChI | InChI=1S/C17H15NO/c1-2-16-13-17(14-9-5-3-6-10-14)18(19-16)15-11-7-4-8-12-15/h1,3-12,16-17H,13H2/t16-,17-/m1/s1 |
| InChIKey | UZCYRRIWVSZKOX-IAGOWNOFSA-N |
| XLogP | 3.57 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|