C16H18N2O2 — CID 11558094
(3S,5R)-5-ethoxy-2-phenyl-3-pyridin-3-yl-1,2-oxazolidine (PubChem CID 11558094) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is (3S,5R)-5-ethoxy-2-phenyl-3-pyridin-3-yl-1,2-oxazolidine.
| Compound Name | (3S,5R)-5-ethoxy-2-phenyl-3-pyridin-3-yl-1,2-oxazolidine |
|---|---|
| PubChem CID | 11558094 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | (3S,5R)-5-ethoxy-2-phenyl-3-pyridin-3-yl-1,2-oxazolidine |
| SMILES | CCO[C@H]1C[C@@H](c2cccnc2)N(c2ccccc2)O1 |
| InChI | InChI=1S/C16H18N2O2/c1-2-19-16-11-15(13-7-6-10-17-12-13)18(20-16)14-8-4-3-5-9-14/h3-10,12,15-16H,2,11H2,1H3/t15-,16+/m0/s1 |
| InChIKey | HPXHXVQLPPABBZ-JKSUJKDBSA-N |
| XLogP | 3.33 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |