C13H19NO2 — CID 23252843
(3R,5R)-5-ethoxy-2-methyl-3-(4-methylphenyl)-1,2-oxazolidine (PubChem CID 23252843) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is (3R,5R)-5-ethoxy-2-methyl-3-(4-methylphenyl)-1,2-oxazolidine.
| Compound Name | (3R,5R)-5-ethoxy-2-methyl-3-(4-methylphenyl)-1,2-oxazolidine |
|---|---|
| PubChem CID | 23252843 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (3R,5R)-5-ethoxy-2-methyl-3-(4-methylphenyl)-1,2-oxazolidine |
| SMILES | CCO[C@H]1C[C@H](c2ccc(C)cc2)N(C)O1 |
| InChI | InChI=1S/C13H19NO2/c1-4-15-13-9-12(14(3)16-13)11-7-5-10(2)6-8-11/h5-8,12-13H,4,9H2,1-3H3/t12-,13-/m1/s1 |
| InChIKey | SOUSDAHMHWZZMU-CHWSQXEVSA-N |
| XLogP | 2.67 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |