About (2R)-2-ethoxy-5-(4-methylphenyl)sulfinyl-3,4-dihydro-2H-pyran
(2R)-2-ethoxy-5-(4-methylphenyl)sulfinyl-3,4-dihydro-2H-pyran (PubChem CID 10923482) has the molecular formula C14H18O3S
and a molecular weight of 266.36 g/mol. Its IUPAC name is (2R)-2-ethoxy-5-(4-methylphenyl)sulfinyl-3,4-dihydro-2H-pyran.
Molecular Properties
| Compound Name | (2R)-2-ethoxy-5-(4-methylphenyl)sulfinyl-3,4-dihydro-2H-pyran |
| PubChem CID | 10923482 |
| Molecular Formula | C14H18O3S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | (2R)-2-ethoxy-5-(4-methylphenyl)sulfinyl-3,4-dihydro-2H-pyran |
| SMILES | CCO[C@H]1CCC(S(=O)c2ccc(C)cc2)=CO1 |
| InChI | InChI=1S/C14H18O3S/c1-3-16-14-9-8-13(10-17-14)18(15)12-6-4-11(2)5-7-12/h4-7,10,14H,3,8-9H2,1-2H3/t14-,18?/m1/s1 |
| InChIKey | ZFYJQMBNZJKTKN-IKJXHCRLSA-N |
| XLogP | 3.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2-ethoxy-5-(4-methylphenyl)sulfinyl-3,4-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-ethoxy-5-(4-methylphenyl)sulfinyl-3,4-dihydro-2H-pyran?
The IUPAC name of (2R)-2-ethoxy-5-(4-methylphenyl)sulfinyl-3,4-dihydro-2H-pyran (CID 10923482) is (2R)-2-ethoxy-5-(4-methylphenyl)sulfinyl-3,4-dihydro-2H-pyran.
What is the SMILES notation for (2R)-2-ethoxy-5-(4-methylphenyl)sulfinyl-3,4-dihydro-2H-pyran?
The canonical SMILES for (2R)-2-ethoxy-5-(4-methylphenyl)sulfinyl-3,4-dihydro-2H-pyran is CCO[C@H]1CCC(S(=O)c2ccc(C)cc2)=CO1.
What is the InChIKey of (2R)-2-ethoxy-5-(4-methylphenyl)sulfinyl-3,4-dihydro-2H-pyran?
The InChIKey is ZFYJQMBNZJKTKN-IKJXHCRLSA-N. The full InChI is InChI=1S/C14H18O3S/c1-3-16-14-9-8-13(10-17-14)18(15)12-6-4-11(2)5-7-12/h4-7,10,14H,3,8-9H2,1-2H3/t14-,18?/m1/s1.
What are the key properties of (2R)-2-ethoxy-5-(4-methylphenyl)sulfinyl-3,4-dihydro-2H-pyran?
(2R)-2-ethoxy-5-(4-methylphenyl)sulfinyl-3,4-dihydro-2H-pyran has a molecular weight of 266.36 g/mol, XLogP of 3.12, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-ethoxy-5-(4-methylphenyl)sulfinyl-3,4-dihydro-2H-pyran is sourced from PubChem (CID 10923482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).