C17H26O4S — CID 134905799
1-[1-(2,2-dimethoxyethyl)cyclohexyl]sulfonyl-4-methylbenzene (PubChem CID 134905799) has the molecular formula C17H26O4S and a molecular weight of 326.46 g/mol. Its IUPAC name is 1-[1-(2,2-dimethoxyethyl)cyclohexyl]sulfonyl-4-methylbenzene.
| Compound Name | 1-[1-(2,2-dimethoxyethyl)cyclohexyl]sulfonyl-4-methylbenzene |
|---|---|
| PubChem CID | 134905799 |
| Molecular Formula | C17H26O4S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 1-[1-(2,2-dimethoxyethyl)cyclohexyl]sulfonyl-4-methylbenzene |
| SMILES | COC(CC1(S(=O)(=O)c2ccc(C)cc2)CCCCC1)OC |
| InChI | InChI=1S/C17H26O4S/c1-14-7-9-15(10-8-14)22(18,19)17(11-5-4-6-12-17)13-16(20-2)21-3/h7-10,16H,4-6,11-13H2,1-3H3 |
| InChIKey | AUWOZPMBBQXKON-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|