C23H30O4S2 — CID 10526844
[(E,3R)-4-[(S)-(4-methylphenyl)sulfinyl]-1-phenylnon-4-en-3-yl] methanesulfonate (PubChem CID 10526844) has the molecular formula C23H30O4S2 and a molecular weight of 434.62 g/mol. Its IUPAC name is [(E,3R)-4-[(S)-(4-methylphenyl)sulfinyl]-1-phenylnon-4-en-3-yl] methanesulfonate.
| Compound Name | [(E,3R)-4-[(S)-(4-methylphenyl)sulfinyl]-1-phenylnon-4-en-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 10526844 |
| Molecular Formula | C23H30O4S2 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | [(E,3R)-4-[(S)-(4-methylphenyl)sulfinyl]-1-phenylnon-4-en-3-yl] methanesulfonate |
| SMILES | CCCC/C=C(\[C@@H](CCc1ccccc1)OS(C)(=O)=O)[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H30O4S2/c1-4-5-7-12-23(28(24)21-16-13-19(2)14-17-21)22(27-29(3,25)26)18-15-20-10-8-6-9-11-20/h6,8-14,16-17,22H,4-5,7,15,18H2,1-3H3/b23-12+/t22-,28+/m1/s1 |
| InChIKey | WIVZLICGSRXXGC-POJXSEJZSA-N |
| XLogP | 5.15 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|