C20H34O4S — CID 11132409
1-[5-(2,2-dimethoxyethyl)nonan-5-ylsulfonyl]-4-methylbenzene (PubChem CID 11132409) has the molecular formula C20H34O4S and a molecular weight of 370.56 g/mol. Its IUPAC name is 1-[5-(2,2-dimethoxyethyl)nonan-5-ylsulfonyl]-4-methylbenzene.
| Compound Name | 1-[5-(2,2-dimethoxyethyl)nonan-5-ylsulfonyl]-4-methylbenzene |
|---|---|
| PubChem CID | 11132409 |
| Molecular Formula | C20H34O4S |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | 1-[5-(2,2-dimethoxyethyl)nonan-5-ylsulfonyl]-4-methylbenzene |
| SMILES | CCCCC(CCCC)(CC(OC)OC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H34O4S/c1-6-8-14-20(15-9-7-2,16-19(23-4)24-5)25(21,22)18-12-10-17(3)11-13-18/h10-13,19H,6-9,14-16H2,1-5H3 |
| InChIKey | LALDFDFXKKITBL-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|