C14H18O4S — CID 14913023
5-(benzenesulfonyl)-2-ethoxy-6-methyl-3,4-dihydro-2H-pyran (PubChem CID 14913023) has the molecular formula C14H18O4S and a molecular weight of 282.36 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-2-ethoxy-6-methyl-3,4-dihydro-2H-pyran.
| Compound Name | 5-(benzenesulfonyl)-2-ethoxy-6-methyl-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 14913023 |
| Molecular Formula | C14H18O4S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 5-(benzenesulfonyl)-2-ethoxy-6-methyl-3,4-dihydro-2H-pyran |
| SMILES | CCOC1CCC(S(=O)(=O)c2ccccc2)=C(C)O1 |
| InChI | InChI=1S/C14H18O4S/c1-3-17-14-10-9-13(11(2)18-14)19(15,16)12-7-5-4-6-8-12/h4-8,14H,3,9-10H2,1-2H3 |
| InChIKey | HEFKPAJXEWXEEF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |