C16H23FO5S — CID 151626620
2-[2-(benzenesulfonyl)-2-fluoroethyl]-5-butan-2-yloxy-1,4-dioxane (PubChem CID 151626620) has the molecular formula C16H23FO5S and a molecular weight of 346.42 g/mol. Its IUPAC name is 2-[2-(benzenesulfonyl)-2-fluoroethyl]-5-butan-2-yloxy-1,4-dioxane.
| Compound Name | 2-[2-(benzenesulfonyl)-2-fluoroethyl]-5-butan-2-yloxy-1,4-dioxane |
|---|---|
| PubChem CID | 151626620 |
| Molecular Formula | C16H23FO5S |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 2-[2-(benzenesulfonyl)-2-fluoroethyl]-5-butan-2-yloxy-1,4-dioxane |
| SMILES | CCC(C)OC1COC(CC(F)S(=O)(=O)c2ccccc2)CO1 |
| InChI | InChI=1S/C16H23FO5S/c1-3-12(2)22-16-11-20-13(10-21-16)9-15(17)23(18,19)14-7-5-4-6-8-14/h4-8,12-13,15-16H,3,9-11H2,1-2H3 |
| InChIKey | QPQGXDDUSLMKQZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |