C21H34O5S — CID 71597311
6-(benzenesulfonylmethyl)-6-methyl-3,3-dipentyl-1,2,4-trioxane (PubChem CID 71597311) has the molecular formula C21H34O5S and a molecular weight of 398.57 g/mol. Its IUPAC name is 6-(benzenesulfonylmethyl)-6-methyl-3,3-dipentyl-1,2,4-trioxane.
| Compound Name | 6-(benzenesulfonylmethyl)-6-methyl-3,3-dipentyl-1,2,4-trioxane |
|---|---|
| PubChem CID | 71597311 |
| Molecular Formula | C21H34O5S |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 6-(benzenesulfonylmethyl)-6-methyl-3,3-dipentyl-1,2,4-trioxane |
| SMILES | CCCCCC1(CCCCC)OCC(C)(CS(=O)(=O)c2ccccc2)OO1 |
| InChI | InChI=1S/C21H34O5S/c1-4-6-11-15-21(16-12-7-5-2)24-17-20(3,25-26-21)18-27(22,23)19-13-9-8-10-14-19/h8-10,13-14H,4-7,11-12,15-18H2,1-3H3 |
| InChIKey | SDRIFSGSBLZPFE-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|