C19H29ClO5S — CID 71597949
3,3-dibutyl-6-[(4-chlorophenyl)sulfonylmethyl]-6-methyl-1,2,4-trioxane (PubChem CID 71597949) has the molecular formula C19H29ClO5S and a molecular weight of 404.96 g/mol. Its IUPAC name is 3,3-dibutyl-6-[(4-chlorophenyl)sulfonylmethyl]-6-methyl-1,2,4-trioxane.
| Compound Name | 3,3-dibutyl-6-[(4-chlorophenyl)sulfonylmethyl]-6-methyl-1,2,4-trioxane |
|---|---|
| PubChem CID | 71597949 |
| Molecular Formula | C19H29ClO5S |
| Molecular Weight | 404.96 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 3,3-dibutyl-6-[(4-chlorophenyl)sulfonylmethyl]-6-methyl-1,2,4-trioxane |
| SMILES | CCCCC1(CCCC)OCC(C)(CS(=O)(=O)c2ccc(Cl)cc2)OO1 |
| InChI | InChI=1S/C19H29ClO5S/c1-4-6-12-19(13-7-5-2)23-14-18(3,24-25-19)15-26(21,22)17-10-8-16(20)9-11-17/h8-11H,4-7,12-15H2,1-3H3 |
| InChIKey | WAYKBULCFVKRML-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.96 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|