C15H19ClO3S — CID 11580482
8-[(4-chlorophenyl)sulfanylmethyl]-8-methyl-6,7,10-trioxaspiro[4.5]decane (PubChem CID 11580482) has the molecular formula C15H19ClO3S and a molecular weight of 314.83 g/mol. Its IUPAC name is 8-[(4-chlorophenyl)sulfanylmethyl]-8-methyl-6,7,10-trioxaspiro[4.5]decane.
| Compound Name | 8-[(4-chlorophenyl)sulfanylmethyl]-8-methyl-6,7,10-trioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 11580482 |
| Molecular Formula | C15H19ClO3S |
| Molecular Weight | 314.83 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 8-[(4-chlorophenyl)sulfanylmethyl]-8-methyl-6,7,10-trioxaspiro[4.5]decane |
| SMILES | CC1(CSc2ccc(Cl)cc2)COC2(CCCC2)OO1 |
| InChI | InChI=1S/C15H19ClO3S/c1-14(11-20-13-6-4-12(16)5-7-13)10-17-15(19-18-14)8-2-3-9-15/h4-7H,2-3,8-11H2,1H3 |
| InChIKey | XRFGCIXIGJBXNY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.83 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|