C21H33ClO3S — CID 71598074
6-[(4-chlorophenyl)sulfanylmethyl]-6-methyl-3,3-dipentyl-1,2,4-trioxane (PubChem CID 71598074) has the molecular formula C21H33ClO3S and a molecular weight of 401.01 g/mol. Its IUPAC name is 6-[(4-chlorophenyl)sulfanylmethyl]-6-methyl-3,3-dipentyl-1,2,4-trioxane.
| Compound Name | 6-[(4-chlorophenyl)sulfanylmethyl]-6-methyl-3,3-dipentyl-1,2,4-trioxane |
|---|---|
| PubChem CID | 71598074 |
| Molecular Formula | C21H33ClO3S |
| Molecular Weight | 401.01 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 6-[(4-chlorophenyl)sulfanylmethyl]-6-methyl-3,3-dipentyl-1,2,4-trioxane |
| SMILES | CCCCCC1(CCCCC)OCC(C)(CSc2ccc(Cl)cc2)OO1 |
| InChI | InChI=1S/C21H33ClO3S/c1-4-6-8-14-21(15-9-7-5-2)23-16-20(3,24-25-21)17-26-19-12-10-18(22)11-13-19/h10-13H,4-9,14-17H2,1-3H3 |
| InChIKey | HSKAJDJEKZOOBP-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.01 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|