C26H35ClO3S — CID 71597171
6-[(4-chlorophenyl)sulfanylmethyl]-3,3-dipentyl-6-phenyl-1,2,4-trioxane (PubChem CID 71597171) has the molecular formula C26H35ClO3S and a molecular weight of 463.08 g/mol. Its IUPAC name is 6-[(4-chlorophenyl)sulfanylmethyl]-3,3-dipentyl-6-phenyl-1,2,4-trioxane.
| Compound Name | 6-[(4-chlorophenyl)sulfanylmethyl]-3,3-dipentyl-6-phenyl-1,2,4-trioxane |
|---|---|
| PubChem CID | 71597171 |
| Molecular Formula | C26H35ClO3S |
| Molecular Weight | 463.08 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 6-[(4-chlorophenyl)sulfanylmethyl]-3,3-dipentyl-6-phenyl-1,2,4-trioxane |
| SMILES | CCCCCC1(CCCCC)OCC(CSc2ccc(Cl)cc2)(c2ccccc2)OO1 |
| InChI | InChI=1S/C26H35ClO3S/c1-3-5-10-18-26(19-11-6-4-2)28-20-25(29-30-26,22-12-8-7-9-13-22)21-31-24-16-14-23(27)15-17-24/h7-9,12-17H,3-6,10-11,18-21H2,1-2H3 |
| InChIKey | VSQUCPYKYQWDPK-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.08 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|