C21H23ClO3S — CID 46210510
3-[(4-chlorophenyl)sulfanylmethyl]-3-phenyl-1,2,5-trioxaspiro[5.5]undecane (PubChem CID 46210510) has the molecular formula C21H23ClO3S and a molecular weight of 390.93 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)sulfanylmethyl]-3-phenyl-1,2,5-trioxaspiro[5.5]undecane.
| Compound Name | 3-[(4-chlorophenyl)sulfanylmethyl]-3-phenyl-1,2,5-trioxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 46210510 |
| Molecular Formula | C21H23ClO3S |
| Molecular Weight | 390.93 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 3-[(4-chlorophenyl)sulfanylmethyl]-3-phenyl-1,2,5-trioxaspiro[5.5]undecane |
| SMILES | Clc1ccc(SCC2(c3ccccc3)COC3(CCCCC3)OO2)cc1 |
| InChI | InChI=1S/C21H23ClO3S/c22-18-9-11-19(12-10-18)26-16-20(17-7-3-1-4-8-17)15-23-21(25-24-20)13-5-2-6-14-21/h1,3-4,7-12H,2,5-6,13-16H2 |
| InChIKey | GBKIVICRCCAZBS-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.93 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|