C19H19ClO3S — CID 134928664
7-[(4-chlorophenyl)sulfanylmethyl]-7-phenyl-5,6,9-trioxaspiro[3.5]nonane (PubChem CID 134928664) has the molecular formula C19H19ClO3S and a molecular weight of 362.88 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)sulfanylmethyl]-7-phenyl-5,6,9-trioxaspiro[3.5]nonane.
| Compound Name | 7-[(4-chlorophenyl)sulfanylmethyl]-7-phenyl-5,6,9-trioxaspiro[3.5]nonane |
|---|---|
| PubChem CID | 134928664 |
| Molecular Formula | C19H19ClO3S |
| Molecular Weight | 362.88 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 7-[(4-chlorophenyl)sulfanylmethyl]-7-phenyl-5,6,9-trioxaspiro[3.5]nonane |
| SMILES | Clc1ccc(SCC2(c3ccccc3)COC3(CCC3)OO2)cc1 |
| InChI | InChI=1S/C19H19ClO3S/c20-16-7-9-17(10-8-16)24-14-18(15-5-2-1-3-6-15)13-21-19(23-22-18)11-4-12-19/h1-3,5-10H,4,11-14H2 |
| InChIKey | ITYCTKXRLMLZHY-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.88 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|